![2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid (CAS: 959237-67-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0743217.png "2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid chemical structure")
2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid
Catalog No: FT-0743217
CAS No: 959237-67-3
- Chemical Name: 2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid
- Molecular Formula: C10H11NO3
- Molecular Weight: 193.2
- InChI Key: KYIDUKKOMMQHMY-UHFFFAOYSA-N
- InChI: InChI=1S/C10H11NO3/c1-14-9-7(10(12)13)5-6-3-2-4-8(6)11-9/h5H,2-4H2,1H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 338.1ºC at 760 mmHg |
|---|---|
| CAS: | 959237-67-3 |
| MF: | C10H11NO3 |
| Density: | 1.302g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | 2-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid |
| Flash_Point: | 158.3ºC |
| FW: | 193.19900 |
| Density: | 1.302g/cm3 |
|---|---|
| MF: | C10H11NO3 |
| LogP: | 1.27710 |
| Exact_Mass: | 193.07400 |
| Bolling_Point: | 338.1ºC at 760 mmHg |
| Flash_Point: | 158.3ºC |
| FW: | 193.19900 |
| Refractive_Index: | 1.591 |
| PSA: | 59.42000 |
| HS_Code: | 2933990090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
